C8H6F3NO5S — CID 170128442
N-(3,4-dihydroxyphenyl)sulfonyl-2,2,2-trifluoroacetamide (PubChem CID 170128442) has the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)sulfonyl-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,4-dihydroxyphenyl)sulfonyl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170128442 |
| Molecular Formula | C8H6F3NO5S |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)sulfonyl-2,2,2-trifluoroacetamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(O)c(O)c1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO5S/c9-8(10,11)7(15)12-18(16,17)4-1-2-5(13)6(14)3-4/h1-3,13-14H,(H,12,15) |
| InChIKey | ORDFNXZNNFPBII-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|