C4HF8NO3S — CID 87267309
2,2,2-trifluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide (PubChem CID 87267309) has the molecular formula C4HF8NO3S and a molecular weight of 295.11 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 87267309 |
| Molecular Formula | C4HF8NO3S |
| Molecular Weight | 295.11 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 2,2,2-trifluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4HF8NO3S/c5-2(6,7)1(14)13-17(15,16)4(11,12)3(8,9)10/h(H,13,14) |
| InChIKey | WSZQKXUNOVGBME-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|