C7HF14NO3S — CID 171725734
2,3,3,3-tetrafluoro-N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl)-2-(trifluoromethyl)propanamide (PubChem CID 171725734) has the molecular formula C7HF14NO3S and a molecular weight of 445.13 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 171725734 |
| Molecular Formula | C7HF14NO3S |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | 2,3,3,3-tetrafluoro-N-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7HF14NO3S/c8-2(4(10,11)12,5(13,14)15)1(23)22-26(24,25)3(9,6(16,17)18)7(19,20)21/h(H,22,23) |
| InChIKey | YQQHXTLKVZMZCL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |