C4H4F5N3O4S — CID 174550629
1-carbamoyl-3-(1,1,2,2,2-pentafluoroethylsulfonyl)urea (PubChem CID 174550629) has the molecular formula C4H4F5N3O4S and a molecular weight of 285.15 g/mol. Its IUPAC name is 1-carbamoyl-3-(1,1,2,2,2-pentafluoroethylsulfonyl)urea.
| Compound Name | 1-carbamoyl-3-(1,1,2,2,2-pentafluoroethylsulfonyl)urea |
|---|---|
| PubChem CID | 174550629 |
| Molecular Formula | C4H4F5N3O4S |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 1-carbamoyl-3-(1,1,2,2,2-pentafluoroethylsulfonyl)urea |
| SMILES | NC(=O)NC(=O)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H4F5N3O4S/c5-3(6,7)4(8,9)17(15,16)12-2(14)11-1(10)13/h(H4,10,11,12,13,14) |
| InChIKey | DCAQFDAYDNZIQW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|