About CID 174966153
CID 174966153 (PubChem CID 174966153) has the molecular formula C2H6N4O4S
and a molecular weight of 182.16 g/mol.
Molecular Properties
| Compound Name | CID 174966153 |
| PubChem CID | 174966153 |
| Molecular Formula | C2H6N4O4S |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | — |
| SMILES | N=S(=O)=O.NC(=O)NC(N)=O |
| InChI | InChI=1S/C2H5N3O2.HNO2S/c3-1(6)5-2(4)7;1-4(2)3/h(H5,3,4,5,6,7);1H |
| InChIKey | DYHLOWVUTDFTKX-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 174966153 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174966153?
The IUPAC name of CID 174966153 (CID 174966153) is not available.
What is the SMILES notation for CID 174966153?
The canonical SMILES for CID 174966153 is N=S(=O)=O.NC(=O)NC(N)=O.
What is the InChIKey of CID 174966153?
The InChIKey is DYHLOWVUTDFTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2.HNO2S/c3-1(6)5-2(4)7;1-4(2)3/h(H5,3,4,5,6,7);1H.
What are the key properties of CID 174966153?
CID 174966153 has a molecular weight of 182.16 g/mol, XLogP of -1.64, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174966153 is sourced from PubChem (CID 174966153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).