About carbamoylurea;isocyanic acid;oxalonitrile
carbamoylurea;isocyanic acid;oxalonitrile (PubChem CID 174975080) has the molecular formula C5H6N6O3
and a molecular weight of 198.14 g/mol. Its IUPAC name is carbamoylurea;isocyanic acid;oxalonitrile.
Molecular Properties
| Compound Name | carbamoylurea;isocyanic acid;oxalonitrile |
| PubChem CID | 174975080 |
| Molecular Formula | C5H6N6O3 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | carbamoylurea;isocyanic acid;oxalonitrile |
| SMILES | N#CC#N.N=C=O.NC(=O)NC(N)=O |
| InChI | InChI=1S/C2H5N3O2.C2N2.CHNO/c3-1(6)5-2(4)7;3-1-2-4;2-1-3/h(H5,3,4,5,6,7);;2H |
| InChIKey | USINBBHNCHKERI-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 186.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze carbamoylurea;isocyanic acid;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;isocyanic acid;oxalonitrile?
The IUPAC name of carbamoylurea;isocyanic acid;oxalonitrile (CID 174975080) is carbamoylurea;isocyanic acid;oxalonitrile.
What is the SMILES notation for carbamoylurea;isocyanic acid;oxalonitrile?
The canonical SMILES for carbamoylurea;isocyanic acid;oxalonitrile is N#CC#N.N=C=O.NC(=O)NC(N)=O.
What is the InChIKey of carbamoylurea;isocyanic acid;oxalonitrile?
The InChIKey is USINBBHNCHKERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2.C2N2.CHNO/c3-1(6)5-2(4)7;3-1-2-4;2-1-3/h(H5,3,4,5,6,7);;2H.
What are the key properties of carbamoylurea;isocyanic acid;oxalonitrile?
carbamoylurea;isocyanic acid;oxalonitrile has a molecular weight of 198.14 g/mol, XLogP of -1.33, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;isocyanic acid;oxalonitrile is sourced from PubChem (CID 174975080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).