About carbamoylurea;fluoroform
carbamoylurea;fluoroform (PubChem CID 174631914) has the molecular formula C3H6F3N3O2
and a molecular weight of 173.09 g/mol. Its IUPAC name is carbamoylurea;fluoroform.
Molecular Properties
| Compound Name | carbamoylurea;fluoroform |
| PubChem CID | 174631914 |
| Molecular Formula | C3H6F3N3O2 |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | carbamoylurea;fluoroform |
| SMILES | FC(F)F.NC(=O)NC(N)=O |
| InChI | InChI=1S/C2H5N3O2.CHF3/c3-1(6)5-2(4)7;2-1(3)4/h(H5,3,4,5,6,7);1H |
| InChIKey | YVXJKUKXDVKSJV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbamoylurea;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;fluoroform?
The IUPAC name of carbamoylurea;fluoroform (CID 174631914) is carbamoylurea;fluoroform.
What is the SMILES notation for carbamoylurea;fluoroform?
The canonical SMILES for carbamoylurea;fluoroform is FC(F)F.NC(=O)NC(N)=O.
What is the InChIKey of carbamoylurea;fluoroform?
The InChIKey is YVXJKUKXDVKSJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2.CHF3/c3-1(6)5-2(4)7;2-1(3)4/h(H5,3,4,5,6,7);1H.
What are the key properties of carbamoylurea;fluoroform?
carbamoylurea;fluoroform has a molecular weight of 173.09 g/mol, XLogP of -0.09, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;fluoroform is sourced from PubChem (CID 174631914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).