About CID 118590953
CID 118590953 (PubChem CID 118590953) has the molecular formula C2H4KN2O3
and a molecular weight of 143.16 g/mol.
Molecular Properties
| Compound Name | CID 118590953 |
| PubChem CID | 118590953 |
| Molecular Formula | C2H4KN2O3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 142.99 |
| IUPAC Name | — |
| SMILES | NC(=O)NC(=O)O.[K] |
| InChI | InChI=1S/C2H4N2O3.K/c3-1(5)4-2(6)7;/h(H,6,7)(H3,3,4,5); |
| InChIKey | IWVGSSQAJNJEOO-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 118590953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118590953?
The IUPAC name of CID 118590953 (CID 118590953) is not available.
What is the SMILES notation for CID 118590953?
The canonical SMILES for CID 118590953 is NC(=O)NC(=O)O.[K].
What is the InChIKey of CID 118590953?
The InChIKey is IWVGSSQAJNJEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2O3.K/c3-1(5)4-2(6)7;/h(H,6,7)(H3,3,4,5);.
What are the key properties of CID 118590953?
CID 118590953 has a molecular weight of 143.16 g/mol, XLogP of -1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118590953 is sourced from PubChem (CID 118590953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).