About N-carbamoylcarbamoyl chloride;carbamoyl chloride
N-carbamoylcarbamoyl chloride;carbamoyl chloride (PubChem CID 170170459) has the molecular formula C3H5Cl2N3O3
and a molecular weight of 202.00 g/mol. Its IUPAC name is N-carbamoylcarbamoyl chloride;carbamoyl chloride.
Molecular Properties
| Compound Name | N-carbamoylcarbamoyl chloride;carbamoyl chloride |
| PubChem CID | 170170459 |
| Molecular Formula | C3H5Cl2N3O3 |
| Molecular Weight | 202.00 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | N-carbamoylcarbamoyl chloride;carbamoyl chloride |
| SMILES | NC(=O)Cl.NC(=O)NC(=O)Cl |
| InChI | InChI=1S/C2H3ClN2O2.CH2ClNO/c3-1(6)5-2(4)7;2-1(3)4/h(H3,4,5,6,7);(H2,3,4) |
| InChIKey | NYASFQKLCRSYLE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.00 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-carbamoylcarbamoyl chloride;carbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoylcarbamoyl chloride;carbamoyl chloride?
The IUPAC name of N-carbamoylcarbamoyl chloride;carbamoyl chloride (CID 170170459) is N-carbamoylcarbamoyl chloride;carbamoyl chloride.
What is the SMILES notation for N-carbamoylcarbamoyl chloride;carbamoyl chloride?
The canonical SMILES for N-carbamoylcarbamoyl chloride;carbamoyl chloride is NC(=O)Cl.NC(=O)NC(=O)Cl.
What is the InChIKey of N-carbamoylcarbamoyl chloride;carbamoyl chloride?
The InChIKey is NYASFQKLCRSYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3ClN2O2.CH2ClNO/c3-1(6)5-2(4)7;2-1(3)4/h(H3,4,5,6,7);(H2,3,4).
What are the key properties of N-carbamoylcarbamoyl chloride;carbamoyl chloride?
N-carbamoylcarbamoyl chloride;carbamoyl chloride has a molecular weight of 202.00 g/mol, XLogP of 0.32, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoylcarbamoyl chloride;carbamoyl chloride is sourced from PubChem (CID 170170459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).