C5H13N3O4 — CID 174530984
carbamoylurea;propane-1,1-diol (PubChem CID 174530984) has the molecular formula C5H13N3O4 and a molecular weight of 179.18 g/mol. Its IUPAC name is carbamoylurea;propane-1,1-diol.
| Compound Name | carbamoylurea;propane-1,1-diol |
|---|---|
| PubChem CID | 174530984 |
| Molecular Formula | C5H13N3O4 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | carbamoylurea;propane-1,1-diol |
| SMILES | CCC(O)O.NC(=O)NC(N)=O |
| InChI | InChI=1S/C3H8O2.C2H5N3O2/c1-2-3(4)5;3-1(6)5-2(4)7/h3-5H,2H2,1H3;(H5,3,4,5,6,7) |
| InChIKey | JNEUQFRQBUTWMY-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|