About molecular iodine;propane-1,1-diol
molecular iodine;propane-1,1-diol (PubChem CID 141479363) has the molecular formula C3H8I2O2
and a molecular weight of 329.90 g/mol. Its IUPAC name is molecular iodine;propane-1,1-diol.
Molecular Properties
| Compound Name | molecular iodine;propane-1,1-diol |
| PubChem CID | 141479363 |
| Molecular Formula | C3H8I2O2 |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.86 |
| IUPAC Name | molecular iodine;propane-1,1-diol |
| SMILES | CCC(O)O.II |
| InChI | InChI=1S/C3H8O2.I2/c1-2-3(4)5;1-2/h3-5H,2H2,1H3; |
| InChIKey | KCARQYXGQTZTGK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze molecular iodine;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular iodine;propane-1,1-diol?
The IUPAC name of molecular iodine;propane-1,1-diol (CID 141479363) is molecular iodine;propane-1,1-diol.
What is the SMILES notation for molecular iodine;propane-1,1-diol?
The canonical SMILES for molecular iodine;propane-1,1-diol is CCC(O)O.II.
What is the InChIKey of molecular iodine;propane-1,1-diol?
The InChIKey is KCARQYXGQTZTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.I2/c1-2-3(4)5;1-2/h3-5H,2H2,1H3;.
What are the key properties of molecular iodine;propane-1,1-diol?
molecular iodine;propane-1,1-diol has a molecular weight of 329.90 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;propane-1,1-diol is sourced from PubChem (CID 141479363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).