About ethanamine;propane-1,1-diol
ethanamine;propane-1,1-diol (PubChem CID 90422212) has the molecular formula C5H15NO2
and a molecular weight of 121.18 g/mol. Its IUPAC name is ethanamine;propane-1,1-diol.
Molecular Properties
| Compound Name | ethanamine;propane-1,1-diol |
| PubChem CID | 90422212 |
| Molecular Formula | C5H15NO2 |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.11 |
| IUPAC Name | ethanamine;propane-1,1-diol |
| SMILES | CCC(O)O.CCN |
| InChI | InChI=1S/C3H8O2.C2H7N/c1-2-3(4)5;1-2-3/h3-5H,2H2,1H3;2-3H2,1H3 |
| InChIKey | NSHWZNGCPUDPJM-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;propane-1,1-diol?
The IUPAC name of ethanamine;propane-1,1-diol (CID 90422212) is ethanamine;propane-1,1-diol.
What is the SMILES notation for ethanamine;propane-1,1-diol?
The canonical SMILES for ethanamine;propane-1,1-diol is CCC(O)O.CCN.
What is the InChIKey of ethanamine;propane-1,1-diol?
The InChIKey is NSHWZNGCPUDPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H7N/c1-2-3(4)5;1-2-3/h3-5H,2H2,1H3;2-3H2,1H3.
What are the key properties of ethanamine;propane-1,1-diol?
ethanamine;propane-1,1-diol has a molecular weight of 121.18 g/mol, XLogP of -0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;propane-1,1-diol is sourced from PubChem (CID 90422212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).