C9H21ClN3O2P — CID 135410023
[(2Z)-2-(carbamoylamino)-2-hydroxyiminoethyl]-triethylphosphanium chloride (PubChem CID 135410023) has the molecular formula C9H21ClN3O2P and a molecular weight of 269.71 g/mol. Its IUPAC name is [(2Z)-2-(carbamoylamino)-2-hydroxyiminoethyl]-triethylphosphanium chloride.
| Compound Name | [(2Z)-2-(carbamoylamino)-2-hydroxyiminoethyl]-triethylphosphanium chloride |
|---|---|
| PubChem CID | 135410023 |
| Molecular Formula | C9H21ClN3O2P |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [(2Z)-2-(carbamoylamino)-2-hydroxyiminoethyl]-triethylphosphanium chloride |
| SMILES | CC[P+](CC)(CC)C/C(=N/O)NC(N)=O.[Cl-] |
| InChI | InChI=1S/C9H20N3O2P.ClH/c1-4-15(5-2,6-3)7-8(12-14)11-9(10)13;/h4-7H2,1-3H3,(H3-,10,11,12,13,14);1H |
| InChIKey | HPRXVQHGRJJDDL-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|