C10H22N4O2 — CID 106277761
3-[(1-amino-1-hydroxyiminopentan-3-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106277761) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(1-amino-1-hydroxyiminopentan-3-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(1-amino-1-hydroxyiminopentan-3-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106277761 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-[(1-amino-1-hydroxyiminopentan-3-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CCC(CC(N)=NO)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H22N4O2/c1-4-7(5-8(11)14-16)13-6-10(2,3)9(12)15/h7,13,16H,4-6H2,1-3H3,(H2,11,14)(H2,12,15) |
| InChIKey | LEJGFJWNAPTORQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|