About carbamoylurea;2-methylhex-2-ene
carbamoylurea;2-methylhex-2-ene (PubChem CID 174255335) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is carbamoylurea;2-methylhex-2-ene.
Molecular Properties
| Compound Name | carbamoylurea;2-methylhex-2-ene |
| PubChem CID | 174255335 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | carbamoylurea;2-methylhex-2-ene |
| SMILES | CCCC=C(C)C.NC(=O)NC(N)=O |
| InChI | InChI=1S/C7H14.C2H5N3O2/c1-4-5-6-7(2)3;3-1(6)5-2(4)7/h6H,4-5H2,1-3H3;(H5,3,4,5,6,7) |
| InChIKey | QMVLZBLLPNHSBL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbamoylurea;2-methylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;2-methylhex-2-ene?
The IUPAC name of carbamoylurea;2-methylhex-2-ene (CID 174255335) is carbamoylurea;2-methylhex-2-ene.
What is the SMILES notation for carbamoylurea;2-methylhex-2-ene?
The canonical SMILES for carbamoylurea;2-methylhex-2-ene is CCCC=C(C)C.NC(=O)NC(N)=O.
What is the InChIKey of carbamoylurea;2-methylhex-2-ene?
The InChIKey is QMVLZBLLPNHSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C2H5N3O2/c1-4-5-6-7(2)3;3-1(6)5-2(4)7/h6H,4-5H2,1-3H3;(H5,3,4,5,6,7).
What are the key properties of carbamoylurea;2-methylhex-2-ene?
carbamoylurea;2-methylhex-2-ene has a molecular weight of 201.27 g/mol, XLogP of 1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;2-methylhex-2-ene is sourced from PubChem (CID 174255335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).