C2H3F2NO — CID 2782321
2,2-difluoroacetamide (PubChem CID 2782321) has the molecular formula C2H3F2NO and a molecular weight of 95.05 g/mol. Its IUPAC name is 2,2-difluoroacetamide.
| Compound Name | 2,2-difluoroacetamide |
|---|---|
| PubChem CID | 2782321 |
| Molecular Formula | C2H3F2NO |
| Molecular Weight | 95.05 g/mol |
| Exact Mass | 95.02 |
| IUPAC Name | 2,2-difluoroacetamide |
| SMILES | NC(=O)C(F)F |
| InChI | InChI=1S/C2H3F2NO/c3-1(4)2(5)6/h1H,(H2,5,6) |
| InChIKey | ZMIBIIAWFMCVFD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.05 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |