About 2,2-difluoroacetamide
2,2-difluoroacetamide (PubChem CID 2782321) has the molecular formula C2H3F2NO
and a molecular weight of 95.05 g/mol. Its IUPAC name is 2,2-difluoroacetamide.
Molecular Properties
| Compound Name | 2,2-difluoroacetamide |
| PubChem CID | 2782321 |
| Molecular Formula | C2H3F2NO |
| Molecular Weight | 95.05 g/mol |
| Exact Mass | 95.02 |
| IUPAC Name | 2,2-difluoroacetamide |
| SMILES | NC(=O)C(F)F |
| InChI | InChI=1S/C2H3F2NO/c3-1(4)2(5)6/h1H,(H2,5,6) |
| InChIKey | ZMIBIIAWFMCVFD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.05 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroacetamide?
The IUPAC name of 2,2-difluoroacetamide (CID 2782321) is 2,2-difluoroacetamide.
What is the SMILES notation for 2,2-difluoroacetamide?
The canonical SMILES for 2,2-difluoroacetamide is NC(=O)C(F)F.
What is the InChIKey of 2,2-difluoroacetamide?
The InChIKey is ZMIBIIAWFMCVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F2NO/c3-1(4)2(5)6/h1H,(H2,5,6).
What are the key properties of 2,2-difluoroacetamide?
2,2-difluoroacetamide has a molecular weight of 95.05 g/mol, XLogP of -0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroacetamide is sourced from PubChem (CID 2782321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).