About ethane-1,2-diol;2-fluoropropanamide
ethane-1,2-diol;2-fluoropropanamide (PubChem CID 175562566) has the molecular formula C5H12FNO3
and a molecular weight of 153.15 g/mol. Its IUPAC name is ethane-1,2-diol;2-fluoropropanamide.
Molecular Properties
| Compound Name | ethane-1,2-diol;2-fluoropropanamide |
| PubChem CID | 175562566 |
| Molecular Formula | C5H12FNO3 |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | ethane-1,2-diol;2-fluoropropanamide |
| SMILES | CC(F)C(N)=O.OCCO |
| InChI | InChI=1S/C3H6FNO.C2H6O2/c1-2(4)3(5)6;3-1-2-4/h2H,1H3,(H2,5,6);3-4H,1-2H2 |
| InChIKey | HMJAYWZKJBHTAL-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane-1,2-diol;2-fluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;2-fluoropropanamide?
The IUPAC name of ethane-1,2-diol;2-fluoropropanamide (CID 175562566) is ethane-1,2-diol;2-fluoropropanamide.
What is the SMILES notation for ethane-1,2-diol;2-fluoropropanamide?
The canonical SMILES for ethane-1,2-diol;2-fluoropropanamide is CC(F)C(N)=O.OCCO.
What is the InChIKey of ethane-1,2-diol;2-fluoropropanamide?
The InChIKey is HMJAYWZKJBHTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FNO.C2H6O2/c1-2(4)3(5)6;3-1-2-4/h2H,1H3,(H2,5,6);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;2-fluoropropanamide?
ethane-1,2-diol;2-fluoropropanamide has a molecular weight of 153.15 g/mol, XLogP of -1.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-fluoropropanamide is sourced from PubChem (CID 175562566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).