C5H12FNO3 — CID 175562566
ethane-1,2-diol;2-fluoropropanamide (PubChem CID 175562566) has the molecular formula C5H12FNO3 and a molecular weight of 153.15 g/mol. Its IUPAC name is ethane-1,2-diol;2-fluoropropanamide.
| Compound Name | ethane-1,2-diol;2-fluoropropanamide |
|---|---|
| PubChem CID | 175562566 |
| Molecular Formula | C5H12FNO3 |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | ethane-1,2-diol;2-fluoropropanamide |
| SMILES | CC(F)C(N)=O.OCCO |
| InChI | InChI=1S/C3H6FNO.C2H6O2/c1-2(4)3(5)6;3-1-2-4/h2H,1H3,(H2,5,6);3-4H,1-2H2 |
| InChIKey | HMJAYWZKJBHTAL-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |