copper;2,2-difluoroacetic acid

C2H2CuF2O2 — CID 88507984

IUPACcopper;2,2-difluoroacetic acid
SMILESO=C(O)C(F)F.[Cu]
InChIInChI=1S/C2H2F2O2.Cu/c3-1(4)2(5)6;/h1H,(H,5,6);
InChIKeyHBIUELVTPFEMSG-UHFFFAOYSA-N
MW159.58 g/mol
LogP0.33
Rot. Bonds1

About copper;2,2-difluoroacetic acid

copper;2,2-difluoroacetic acid (PubChem CID 88507984) has the molecular formula C2H2CuF2O2 and a molecular weight of 159.58 g/mol. Its IUPAC name is copper;2,2-difluoroacetic acid.

Molecular Properties

Compound Namecopper;2,2-difluoroacetic acid
PubChem CID88507984
Molecular FormulaC2H2CuF2O2
Molecular Weight159.58 g/mol
Exact Mass158.93
IUPAC Namecopper;2,2-difluoroacetic acid
SMILESO=C(O)C(F)F.[Cu]
InChIInChI=1S/C2H2F2O2.Cu/c3-1(4)2(5)6;/h1H,(H,5,6);
InChIKeyHBIUELVTPFEMSG-UHFFFAOYSA-N
XLogP0.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.58
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze copper;2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper;2,2-difluoroacetic acid?
The IUPAC name of copper;2,2-difluoroacetic acid (CID 88507984) is copper;2,2-difluoroacetic acid.
What is the SMILES notation for copper;2,2-difluoroacetic acid?
The canonical SMILES for copper;2,2-difluoroacetic acid is O=C(O)C(F)F.[Cu].
What is the InChIKey of copper;2,2-difluoroacetic acid?
The InChIKey is HBIUELVTPFEMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2O2.Cu/c3-1(4)2(5)6;/h1H,(H,5,6);.
What are the key properties of copper;2,2-difluoroacetic acid?
copper;2,2-difluoroacetic acid has a molecular weight of 159.58 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2,2-difluoroacetic acid is sourced from PubChem (CID 88507984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).