C7H6F8O3 — CID 135262109
2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene;carbonic acid (PubChem CID 135262109) has the molecular formula C7H6F8O3 and a molecular weight of 290.11 g/mol. Its IUPAC name is 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene;carbonic acid.
| Compound Name | 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene;carbonic acid |
|---|---|
| PubChem CID | 135262109 |
| Molecular Formula | C7H6F8O3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene;carbonic acid |
| SMILES | FC(F)C(=C(C(F)F)C(F)F)C(F)F.O=C(O)O |
| InChI | InChI=1S/C6H4F8.CH2O3/c7-3(8)1(4(9)10)2(5(11)12)6(13)14;2-1(3)4/h3-6H;(H2,2,3,4) |
| InChIKey | MOGVHGMRBKIGRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|