C15H25N3O2 — CID 174706282
carbamoylurea;2-methyl-1,3-di(propan-2-yl)benzene (PubChem CID 174706282) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is carbamoylurea;2-methyl-1,3-di(propan-2-yl)benzene.
| Compound Name | carbamoylurea;2-methyl-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 174706282 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | carbamoylurea;2-methyl-1,3-di(propan-2-yl)benzene |
| SMILES | Cc1c(C(C)C)cccc1C(C)C.NC(=O)NC(N)=O |
| InChI | InChI=1S/C13H20.C2H5N3O2/c1-9(2)12-7-6-8-13(10(3)4)11(12)5;3-1(6)5-2(4)7/h6-10H,1-5H3;(H5,3,4,5,6,7) |
| InChIKey | SFOZRMXVAQOPIO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |