C27H38N2O2 — CID 142656757
2,2-bis[2,6-di(propan-2-yl)phenyl]propanediamide (PubChem CID 142656757) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2,2-bis[2,6-di(propan-2-yl)phenyl]propanediamide.
| Compound Name | 2,2-bis[2,6-di(propan-2-yl)phenyl]propanediamide |
|---|---|
| PubChem CID | 142656757 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2,2-bis[2,6-di(propan-2-yl)phenyl]propanediamide |
| SMILES | CC(C)c1cccc(C(C)C)c1C(C(N)=O)(C(N)=O)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C27H38N2O2/c1-15(2)19-11-9-12-20(16(3)4)23(19)27(25(28)30,26(29)31)24-21(17(5)6)13-10-14-22(24)18(7)8/h9-18H,1-8H3,(H2,28,30)(H2,29,31) |
| InChIKey | AYQLCULFFRPEIE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|