C18H30N2O5 — CID 97050456
(2R)-2-[bis(1,1-dihydroxyethyl)amino]-2-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 97050456) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2R)-2-[bis(1,1-dihydroxyethyl)amino]-2-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | (2R)-2-[bis(1,1-dihydroxyethyl)amino]-2-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 97050456 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2R)-2-[bis(1,1-dihydroxyethyl)amino]-2-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1[C@H](C(N)=O)N(C(C)(O)O)C(C)(O)O |
| InChI | InChI=1S/C18H30N2O5/c1-10(2)12-8-7-9-13(11(3)4)14(12)15(16(19)21)20(17(5,22)23)18(6,24)25/h7-11,15,22-25H,1-6H3,(H2,19,21)/t15-/m1/s1 |
| InChIKey | XJPZLGQNBJBYKO-OAHLLOKOSA-N |
| XLogP | 1.08 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|