C16H24O — CID 87916121
2-[2,3-di(propan-2-yl)phenyl]-2-methylpropanal (PubChem CID 87916121) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[2,3-di(propan-2-yl)phenyl]-2-methylpropanal.
| Compound Name | 2-[2,3-di(propan-2-yl)phenyl]-2-methylpropanal |
|---|---|
| PubChem CID | 87916121 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[2,3-di(propan-2-yl)phenyl]-2-methylpropanal |
| SMILES | CC(C)c1cccc(C(C)(C)C=O)c1C(C)C |
| InChI | InChI=1S/C16H24O/c1-11(2)13-8-7-9-14(15(13)12(3)4)16(5,6)10-17/h7-12H,1-6H3 |
| InChIKey | VFPARZVCTRSYHL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|