About sodium;1-bromo-3-carbamoylurea;hydride
sodium;1-bromo-3-carbamoylurea;hydride (PubChem CID 174408388) has the molecular formula C2H5BrN3NaO2
and a molecular weight of 205.98 g/mol. Its IUPAC name is sodium;1-bromo-3-carbamoylurea;hydride.
Molecular Properties
| Compound Name | sodium;1-bromo-3-carbamoylurea;hydride |
| PubChem CID | 174408388 |
| Molecular Formula | C2H5BrN3NaO2 |
| Molecular Weight | 205.98 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | sodium;1-bromo-3-carbamoylurea;hydride |
| SMILES | NC(=O)NC(=O)NBr.[H-].[Na+] |
| InChI | InChI=1S/C2H4BrN3O2.Na.H/c3-6-2(8)5-1(4)7;;/h(H4,4,5,6,7,8);;/q;+1;-1 |
| InChIKey | YLBYAQKUNZNEDS-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.98 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-bromo-3-carbamoylurea;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-bromo-3-carbamoylurea;hydride?
The IUPAC name of sodium;1-bromo-3-carbamoylurea;hydride (CID 174408388) is sodium;1-bromo-3-carbamoylurea;hydride.
What is the SMILES notation for sodium;1-bromo-3-carbamoylurea;hydride?
The canonical SMILES for sodium;1-bromo-3-carbamoylurea;hydride is NC(=O)NC(=O)NBr.[H-].[Na+].
What is the InChIKey of sodium;1-bromo-3-carbamoylurea;hydride?
The InChIKey is YLBYAQKUNZNEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4BrN3O2.Na.H/c3-6-2(8)5-1(4)7;;/h(H4,4,5,6,7,8);;/q;+1;-1.
What are the key properties of sodium;1-bromo-3-carbamoylurea;hydride?
sodium;1-bromo-3-carbamoylurea;hydride has a molecular weight of 205.98 g/mol, XLogP of -3.21, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-bromo-3-carbamoylurea;hydride is sourced from PubChem (CID 174408388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).