About lithium;bromourea;bromide
lithium;bromourea;bromide (PubChem CID 175098948) has the molecular formula CH3Br2LiN2O
and a molecular weight of 225.80 g/mol. Its IUPAC name is lithium;bromourea;bromide.
Molecular Properties
| Compound Name | lithium;bromourea;bromide |
| PubChem CID | 175098948 |
| Molecular Formula | CH3Br2LiN2O |
| Molecular Weight | 225.80 g/mol |
| Exact Mass | 223.88 |
| IUPAC Name | lithium;bromourea;bromide |
| SMILES | NC(=O)NBr.[Br-].[Li+] |
| InChI | InChI=1S/CH3BrN2O.BrH.Li/c2-4-1(3)5;;/h(H3,3,4,5);1H;/q;;+1/p-1 |
| InChIKey | CBFDHJGMZDABAT-UHFFFAOYSA-M |
| XLogP | -6.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.80 |
| LogP ≤ 5 | -6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze lithium;bromourea;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;bromourea;bromide?
The IUPAC name of lithium;bromourea;bromide (CID 175098948) is lithium;bromourea;bromide.
What is the SMILES notation for lithium;bromourea;bromide?
The canonical SMILES for lithium;bromourea;bromide is NC(=O)NBr.[Br-].[Li+].
What is the InChIKey of lithium;bromourea;bromide?
The InChIKey is CBFDHJGMZDABAT-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3BrN2O.BrH.Li/c2-4-1(3)5;;/h(H3,3,4,5);1H;/q;;+1/p-1.
What are the key properties of lithium;bromourea;bromide?
lithium;bromourea;bromide has a molecular weight of 225.80 g/mol, XLogP of -6.03, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bromourea;bromide is sourced from PubChem (CID 175098948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).