About hydroxyurea;dihydrochloride
hydroxyurea;dihydrochloride (PubChem CID 175264488) has the molecular formula CH6Cl2N2O2
and a molecular weight of 148.98 g/mol. Its IUPAC name is hydroxyurea;dihydrochloride.
Molecular Properties
| Compound Name | hydroxyurea;dihydrochloride |
| PubChem CID | 175264488 |
| Molecular Formula | CH6Cl2N2O2 |
| Molecular Weight | 148.98 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | hydroxyurea;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)NO |
| InChI | InChI=1S/CH4N2O2.2ClH/c2-1(4)3-5;;/h5H,(H3,2,3,4);2*1H |
| InChIKey | KHVVBCFBZLNSJM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.98 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxyurea;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxyurea;dihydrochloride?
The IUPAC name of hydroxyurea;dihydrochloride (CID 175264488) is hydroxyurea;dihydrochloride.
What is the SMILES notation for hydroxyurea;dihydrochloride?
The canonical SMILES for hydroxyurea;dihydrochloride is Cl.Cl.NC(=O)NO.
What is the InChIKey of hydroxyurea;dihydrochloride?
The InChIKey is KHVVBCFBZLNSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O2.2ClH/c2-1(4)3-5;;/h5H,(H3,2,3,4);2*1H.
What are the key properties of hydroxyurea;dihydrochloride?
hydroxyurea;dihydrochloride has a molecular weight of 148.98 g/mol, XLogP of -0.11, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxyurea;dihydrochloride is sourced from PubChem (CID 175264488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).