About CID 173237266
CID 173237266 (PubChem CID 173237266) has the molecular formula CH5N2OSi
and a molecular weight of 89.15 g/mol.
Molecular Properties
| Compound Name | CID 173237266 |
| PubChem CID | 173237266 |
| Molecular Formula | CH5N2OSi |
| Molecular Weight | 89.15 g/mol |
| Exact Mass | 89.02 |
| IUPAC Name | — |
| SMILES | NC(=O)N[SiH2] |
| InChI | InChI=1S/CH5N2OSi/c2-1(4)3-5/h5H2,(H3,2,3,4) |
| InChIKey | QBNPQOBCDKPDDX-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.15 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173237266 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173237266?
The IUPAC name of CID 173237266 (CID 173237266) is not available.
What is the SMILES notation for CID 173237266?
The canonical SMILES for CID 173237266 is NC(=O)N[SiH2].
What is the InChIKey of CID 173237266?
The InChIKey is QBNPQOBCDKPDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N2OSi/c2-1(4)3-5/h5H2,(H3,2,3,4).
What are the key properties of CID 173237266?
CID 173237266 has a molecular weight of 89.15 g/mol, XLogP of -1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173237266 is sourced from PubChem (CID 173237266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).