About 2-hydroxyethylurea;iron
2-hydroxyethylurea;iron (PubChem CID 174789558) has the molecular formula C3H8FeN2O2
and a molecular weight of 159.95 g/mol. Its IUPAC name is 2-hydroxyethylurea;iron.
Molecular Properties
| Compound Name | 2-hydroxyethylurea;iron |
| PubChem CID | 174789558 |
| Molecular Formula | C3H8FeN2O2 |
| Molecular Weight | 159.95 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | 2-hydroxyethylurea;iron |
| SMILES | NC(=O)NCCO.[Fe] |
| InChI | InChI=1S/C3H8N2O2.Fe/c4-3(7)5-1-2-6;/h6H,1-2H2,(H3,4,5,7); |
| InChIKey | XXPFZCKFXSYREP-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.95 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethylurea;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethylurea;iron?
The IUPAC name of 2-hydroxyethylurea;iron (CID 174789558) is 2-hydroxyethylurea;iron.
What is the SMILES notation for 2-hydroxyethylurea;iron?
The canonical SMILES for 2-hydroxyethylurea;iron is NC(=O)NCCO.[Fe].
What is the InChIKey of 2-hydroxyethylurea;iron?
The InChIKey is XXPFZCKFXSYREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2.Fe/c4-3(7)5-1-2-6;/h6H,1-2H2,(H3,4,5,7);.
What are the key properties of 2-hydroxyethylurea;iron?
2-hydroxyethylurea;iron has a molecular weight of 159.95 g/mol, XLogP of -1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethylurea;iron is sourced from PubChem (CID 174789558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).