About ethane;2-hydroxyethylurea
ethane;2-hydroxyethylurea (PubChem CID 144763401) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is ethane;2-hydroxyethylurea.
Molecular Properties
| Compound Name | ethane;2-hydroxyethylurea |
| PubChem CID | 144763401 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | ethane;2-hydroxyethylurea |
| SMILES | CC.NC(=O)NCCO |
| InChI | InChI=1S/C3H8N2O2.C2H6/c4-3(7)5-1-2-6;1-2/h6H,1-2H2,(H3,4,5,7);1-2H3 |
| InChIKey | UCSWWGUXVSTLQW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-hydroxyethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-hydroxyethylurea?
The IUPAC name of ethane;2-hydroxyethylurea (CID 144763401) is ethane;2-hydroxyethylurea.
What is the SMILES notation for ethane;2-hydroxyethylurea?
The canonical SMILES for ethane;2-hydroxyethylurea is CC.NC(=O)NCCO.
What is the InChIKey of ethane;2-hydroxyethylurea?
The InChIKey is UCSWWGUXVSTLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2.C2H6/c4-3(7)5-1-2-6;1-2/h6H,1-2H2,(H3,4,5,7);1-2H3.
What are the key properties of ethane;2-hydroxyethylurea?
ethane;2-hydroxyethylurea has a molecular weight of 134.18 g/mol, XLogP of -0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydroxyethylurea is sourced from PubChem (CID 144763401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).