About 3-oxopentylurea
3-oxopentylurea (PubChem CID 19425945) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-oxopentylurea.
Molecular Properties
| Compound Name | 3-oxopentylurea |
| PubChem CID | 19425945 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3-oxopentylurea |
| SMILES | CCC(=O)CCNC(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-2-5(9)3-4-8-6(7)10/h2-4H2,1H3,(H3,7,8,10) |
| InChIKey | NOQAWNIKLYFTII-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-oxopentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopentylurea?
The IUPAC name of 3-oxopentylurea (CID 19425945) is 3-oxopentylurea.
What is the SMILES notation for 3-oxopentylurea?
The canonical SMILES for 3-oxopentylurea is CCC(=O)CCNC(N)=O.
What is the InChIKey of 3-oxopentylurea?
The InChIKey is NOQAWNIKLYFTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-2-5(9)3-4-8-6(7)10/h2-4H2,1H3,(H3,7,8,10).
What are the key properties of 3-oxopentylurea?
3-oxopentylurea has a molecular weight of 144.17 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopentylurea is sourced from PubChem (CID 19425945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).