C11H22N2O3 — CID 144594706
2-amino-4-hydroxy-3,3-dimethyl-N-(3-oxopentyl)butanamide (PubChem CID 144594706) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-amino-4-hydroxy-3,3-dimethyl-N-(3-oxopentyl)butanamide.
| Compound Name | 2-amino-4-hydroxy-3,3-dimethyl-N-(3-oxopentyl)butanamide |
|---|---|
| PubChem CID | 144594706 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-amino-4-hydroxy-3,3-dimethyl-N-(3-oxopentyl)butanamide |
| SMILES | CCC(=O)CCNC(=O)C(N)C(C)(C)CO |
| InChI | InChI=1S/C11H22N2O3/c1-4-8(15)5-6-13-10(16)9(12)11(2,3)7-14/h9,14H,4-7,12H2,1-3H3,(H,13,16) |
| InChIKey | FAUNXTQRELELSL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |