C15H28N4O5 — CID 171804428
N-[2-[4-(carbamoylamino)butylamino]-2-oxoethyl]-3-(3-oxopentoxy)propanamide (PubChem CID 171804428) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[2-[4-(carbamoylamino)butylamino]-2-oxoethyl]-3-(3-oxopentoxy)propanamide.
| Compound Name | N-[2-[4-(carbamoylamino)butylamino]-2-oxoethyl]-3-(3-oxopentoxy)propanamide |
|---|---|
| PubChem CID | 171804428 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[2-[4-(carbamoylamino)butylamino]-2-oxoethyl]-3-(3-oxopentoxy)propanamide |
| SMILES | CCC(=O)CCOCCC(=O)NCC(=O)NCCCCNC(N)=O |
| InChI | InChI=1S/C15H28N4O5/c1-2-12(20)5-9-24-10-6-13(21)19-11-14(22)17-7-3-4-8-18-15(16)23/h2-11H2,1H3,(H,17,22)(H,19,21)(H3,16,18,23) |
| InChIKey | DQVIWLUAVUOFQH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|