C14H25N3O4 — CID 178008548
N-[3-[[3-(ethylamino)-3-oxopropyl]amino]-3-oxopropyl]-4-oxohexanamide (PubChem CID 178008548) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[3-[[3-(ethylamino)-3-oxopropyl]amino]-3-oxopropyl]-4-oxohexanamide.
| Compound Name | N-[3-[[3-(ethylamino)-3-oxopropyl]amino]-3-oxopropyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 178008548 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-[3-[[3-(ethylamino)-3-oxopropyl]amino]-3-oxopropyl]-4-oxohexanamide |
| SMILES | CCNC(=O)CCNC(=O)CCNC(=O)CCC(=O)CC |
| InChI | InChI=1S/C14H25N3O4/c1-3-11(18)5-6-12(19)16-10-8-14(21)17-9-7-13(20)15-4-2/h3-10H2,1-2H3,(H,15,20)(H,16,19)(H,17,21) |
| InChIKey | XTMFYKGQPNDZAS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |