C11H22N4O3 — CID 87037238
3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-N-propylpropanamide (PubChem CID 87037238) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-N-propylpropanamide.
| Compound Name | 3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 87037238 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNC(=O)NCC(=O)NCC |
| InChI | InChI=1S/C11H22N4O3/c1-3-6-13-9(16)5-7-14-11(18)15-8-10(17)12-4-2/h3-8H2,1-2H3,(H,12,17)(H,13,16)(H2,14,15,18) |
| InChIKey | CVKAESWKULVQLM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |