About methylurea;ruthenium
methylurea;ruthenium (PubChem CID 159209634) has the molecular formula C2H6N2ORu
and a molecular weight of 175.15 g/mol. Its IUPAC name is methylurea;ruthenium.
Molecular Properties
| Compound Name | methylurea;ruthenium |
| PubChem CID | 159209634 |
| Molecular Formula | C2H6N2ORu |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.95 |
| IUPAC Name | methylurea;ruthenium |
| SMILES | CNC(N)=O.[Ru] |
| InChI | InChI=1S/C2H6N2O.Ru/c1-4-2(3)5;/h1H3,(H3,3,4,5); |
| InChIKey | KQIDQYZKZASBAH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylurea;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylurea;ruthenium?
The IUPAC name of methylurea;ruthenium (CID 159209634) is methylurea;ruthenium.
What is the SMILES notation for methylurea;ruthenium?
The canonical SMILES for methylurea;ruthenium is CNC(N)=O.[Ru].
What is the InChIKey of methylurea;ruthenium?
The InChIKey is KQIDQYZKZASBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.Ru/c1-4-2(3)5;/h1H3,(H3,3,4,5);.
What are the key properties of methylurea;ruthenium?
methylurea;ruthenium has a molecular weight of 175.15 g/mol, XLogP of -0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylurea;ruthenium is sourced from PubChem (CID 159209634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).