About sodium;methylurea;nitrite
sodium;methylurea;nitrite (PubChem CID 23667525) has the molecular formula C2H6N3NaO3
and a molecular weight of 143.08 g/mol. Its IUPAC name is sodium;methylurea;nitrite.
Molecular Properties
| Compound Name | sodium;methylurea;nitrite |
| PubChem CID | 23667525 |
| Molecular Formula | C2H6N3NaO3 |
| Molecular Weight | 143.08 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | sodium;methylurea;nitrite |
| SMILES | CNC(N)=O.O=N[O-].[Na+] |
| InChI | InChI=1S/C2H6N2O.HNO2.Na/c1-4-2(3)5;2-1-3;/h1H3,(H3,3,4,5);(H,2,3);/q;;+1/p-1 |
| InChIKey | WBXZPIIPCGQRTG-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.08 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;methylurea;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methylurea;nitrite?
The IUPAC name of sodium;methylurea;nitrite (CID 23667525) is sodium;methylurea;nitrite.
What is the SMILES notation for sodium;methylurea;nitrite?
The canonical SMILES for sodium;methylurea;nitrite is CNC(N)=O.O=N[O-].[Na+].
What is the InChIKey of sodium;methylurea;nitrite?
The InChIKey is WBXZPIIPCGQRTG-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H6N2O.HNO2.Na/c1-4-2(3)5;2-1-3;/h1H3,(H3,3,4,5);(H,2,3);/q;;+1/p-1.
What are the key properties of sodium;methylurea;nitrite?
sodium;methylurea;nitrite has a molecular weight of 143.08 g/mol, XLogP of -3.46, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methylurea;nitrite is sourced from PubChem (CID 23667525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).