About methylurea;prop-2-ynoic acid
methylurea;prop-2-ynoic acid (PubChem CID 172728216) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is methylurea;prop-2-ynoic acid.
Molecular Properties
| Compound Name | methylurea;prop-2-ynoic acid |
| PubChem CID | 172728216 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | methylurea;prop-2-ynoic acid |
| SMILES | C#CC(=O)O.CNC(N)=O |
| InChI | InChI=1S/C3H2O2.C2H6N2O/c1-2-3(4)5;1-4-2(3)5/h1H,(H,4,5);1H3,(H3,3,4,5) |
| InChIKey | HKYIOLILYPSDMT-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methylurea;prop-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylurea;prop-2-ynoic acid?
The IUPAC name of methylurea;prop-2-ynoic acid (CID 172728216) is methylurea;prop-2-ynoic acid.
What is the SMILES notation for methylurea;prop-2-ynoic acid?
The canonical SMILES for methylurea;prop-2-ynoic acid is C#CC(=O)O.CNC(N)=O.
What is the InChIKey of methylurea;prop-2-ynoic acid?
The InChIKey is HKYIOLILYPSDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2O2.C2H6N2O/c1-2-3(4)5;1-4-2(3)5/h1H,(H,4,5);1H3,(H3,3,4,5).
What are the key properties of methylurea;prop-2-ynoic acid?
methylurea;prop-2-ynoic acid has a molecular weight of 144.13 g/mol, XLogP of -1.01, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylurea;prop-2-ynoic acid is sourced from PubChem (CID 172728216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).