About prop-2-ynoic acid;titanium
prop-2-ynoic acid;titanium (PubChem CID 18781419) has the molecular formula C3H2O2Ti
and a molecular weight of 117.91 g/mol. Its IUPAC name is prop-2-ynoic acid;titanium.
Molecular Properties
| Compound Name | prop-2-ynoic acid;titanium |
| PubChem CID | 18781419 |
| Molecular Formula | C3H2O2Ti |
| Molecular Weight | 117.91 g/mol |
| Exact Mass | 117.95 |
| IUPAC Name | prop-2-ynoic acid;titanium |
| SMILES | C#CC(=O)O.[Ti] |
| InChI | InChI=1S/C3H2O2.Ti/c1-2-3(4)5;/h1H,(H,4,5); |
| InChIKey | QCHBGLXLCZWYOE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.91 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynoic acid;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynoic acid;titanium?
The IUPAC name of prop-2-ynoic acid;titanium (CID 18781419) is prop-2-ynoic acid;titanium.
What is the SMILES notation for prop-2-ynoic acid;titanium?
The canonical SMILES for prop-2-ynoic acid;titanium is C#CC(=O)O.[Ti].
What is the InChIKey of prop-2-ynoic acid;titanium?
The InChIKey is QCHBGLXLCZWYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2O2.Ti/c1-2-3(4)5;/h1H,(H,4,5);.
What are the key properties of prop-2-ynoic acid;titanium?
prop-2-ynoic acid;titanium has a molecular weight of 117.91 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynoic acid;titanium is sourced from PubChem (CID 18781419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).