About 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid
4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid (PubChem CID 157393177) has the molecular formula C8H3Br3F4O4
and a molecular weight of 478.81 g/mol. Its IUPAC name is 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid.
Molecular Properties
| Compound Name | 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid |
| PubChem CID | 157393177 |
| Molecular Formula | C8H3Br3F4O4 |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 475.75 |
| IUPAC Name | 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid |
| SMILES | C#CC(=O)O.FC(F)(Br)Br.O=C(O)C#CC(F)(F)Br |
| InChI | InChI=1S/C4HBrF2O2.C3H2O2.CBr2F2/c5-4(6,7)2-1-3(8)9;1-2-3(4)5;2-1(3,4)5/h(H,8,9);1H,(H,4,5); |
| InChIKey | BMGHODSIUMXTKA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid?
The IUPAC name of 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid (CID 157393177) is 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid.
What is the SMILES notation for 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid?
The canonical SMILES for 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid is C#CC(=O)O.FC(F)(Br)Br.O=C(O)C#CC(F)(F)Br.
What is the InChIKey of 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid?
The InChIKey is BMGHODSIUMXTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBrF2O2.C3H2O2.CBr2F2/c5-4(6,7)2-1-3(8)9;1-2-3(4)5;2-1(3,4)5/h(H,8,9);1H,(H,4,5);.
What are the key properties of 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid?
4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid has a molecular weight of 478.81 g/mol, XLogP of 3.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-4,4-difluorobut-2-ynoic acid;dibromo(difluoro)methane;prop-2-ynoic acid is sourced from PubChem (CID 157393177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).