C6Br4F6O2 — CID 170155777
3,3,4,4-tetrabromo-1,1,1,6,6,6-hexafluorohexane-2,5-dione (PubChem CID 170155777) has the molecular formula C6Br4F6O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 3,3,4,4-tetrabromo-1,1,1,6,6,6-hexafluorohexane-2,5-dione.
| Compound Name | 3,3,4,4-tetrabromo-1,1,1,6,6,6-hexafluorohexane-2,5-dione |
|---|---|
| PubChem CID | 170155777 |
| Molecular Formula | C6Br4F6O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 533.65 |
| IUPAC Name | 3,3,4,4-tetrabromo-1,1,1,6,6,6-hexafluorohexane-2,5-dione |
| SMILES | O=C(C(F)(F)F)C(Br)(Br)C(Br)(Br)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6Br4F6O2/c7-3(8,1(17)5(11,12)13)4(9,10)2(18)6(14,15)16 |
| InChIKey | KRLIHMVKDYDNDQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|