C6H2F12O2 — CID 159576724
1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-one (PubChem CID 159576724) has the molecular formula C6H2F12O2 and a molecular weight of 334.06 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-one.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-one |
|---|---|
| PubChem CID | 159576724 |
| Molecular Formula | C6H2F12O2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ol;1,1,1,3,3,3-hexafluoropropan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)F.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6O.C3F6O/c2*4-2(5,6)1(10)3(7,8)9/h1,10H; |
| InChIKey | MIMPCUIHEKKOGN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |