C4H2F8O — CID 98055023
(2S)-1,1,1,3,3,4,4,4-octafluorobutan-2-ol (PubChem CID 98055023) has the molecular formula C4H2F8O and a molecular weight of 218.04 g/mol. Its IUPAC name is (2S)-1,1,1,3,3,4,4,4-octafluorobutan-2-ol.
| Compound Name | (2S)-1,1,1,3,3,4,4,4-octafluorobutan-2-ol |
|---|---|
| PubChem CID | 98055023 |
| Molecular Formula | C4H2F8O |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | (2S)-1,1,1,3,3,4,4,4-octafluorobutan-2-ol |
| SMILES | O[C@H](C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F8O/c5-2(6,4(10,11)12)1(13)3(7,8)9/h1,13H/t1-/m0/s1 |
| InChIKey | ZVXAXABPTOPGDK-SFOWXEAESA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|