C4H6F5NO — CID 129368619
(2S)-1-amino-3,3,4,4,4-pentafluorobutan-2-ol (PubChem CID 129368619) has the molecular formula C4H6F5NO and a molecular weight of 179.09 g/mol. Its IUPAC name is (2S)-1-amino-3,3,4,4,4-pentafluorobutan-2-ol.
| Compound Name | (2S)-1-amino-3,3,4,4,4-pentafluorobutan-2-ol |
|---|---|
| PubChem CID | 129368619 |
| Molecular Formula | C4H6F5NO |
| Molecular Weight | 179.09 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (2S)-1-amino-3,3,4,4,4-pentafluorobutan-2-ol |
| SMILES | NC[C@H](O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H6F5NO/c5-3(6,2(11)1-10)4(7,8)9/h2,11H,1,10H2/t2-/m0/s1 |
| InChIKey | FSQUFJQIPQSOBE-REOHCLBHSA-N |
| XLogP | 0.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.09 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|