C8H5F10IO — CID 172713124
1,1,1,2,2,7,7,8,8,8-decafluoro-5-iodooct-5-en-3-ol (PubChem CID 172713124) has the molecular formula C8H5F10IO and a molecular weight of 434.01 g/mol. Its IUPAC name is 1,1,1,2,2,7,7,8,8,8-decafluoro-5-iodooct-5-en-3-ol.
| Compound Name | 1,1,1,2,2,7,7,8,8,8-decafluoro-5-iodooct-5-en-3-ol |
|---|---|
| PubChem CID | 172713124 |
| Molecular Formula | C8H5F10IO |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 1,1,1,2,2,7,7,8,8,8-decafluoro-5-iodooct-5-en-3-ol |
| SMILES | OC(CC(I)=CC(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F10IO/c9-5(10,7(13,14)15)2-3(19)1-4(20)6(11,12)8(16,17)18/h2,4,20H,1H2 |
| InChIKey | FMVDDDKWBANTAV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|