C9H13F5O3S — CID 163639044
1-(1,1-dioxothian-4-yl)-3,3,4,4,4-pentafluorobutan-2-ol (PubChem CID 163639044) has the molecular formula C9H13F5O3S and a molecular weight of 296.26 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-3,3,4,4,4-pentafluorobutan-2-ol.
| Compound Name | 1-(1,1-dioxothian-4-yl)-3,3,4,4,4-pentafluorobutan-2-ol |
|---|---|
| PubChem CID | 163639044 |
| Molecular Formula | C9H13F5O3S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-3,3,4,4,4-pentafluorobutan-2-ol |
| SMILES | O=S1(=O)CCC(CC(O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F5O3S/c10-8(11,9(12,13)14)7(15)5-6-1-3-18(16,17)4-2-6/h6-7,15H,1-5H2 |
| InChIKey | XOCXWZDQQFIEHN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|