C10H16F4O3S — CID 163639046
1-(1,1-dioxothian-4-yl)-3,3,4,4-tetrafluoropentan-2-ol (PubChem CID 163639046) has the molecular formula C10H16F4O3S and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-3,3,4,4-tetrafluoropentan-2-ol.
| Compound Name | 1-(1,1-dioxothian-4-yl)-3,3,4,4-tetrafluoropentan-2-ol |
|---|---|
| PubChem CID | 163639046 |
| Molecular Formula | C10H16F4O3S |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-3,3,4,4-tetrafluoropentan-2-ol |
| SMILES | CC(F)(F)C(F)(F)C(O)CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H16F4O3S/c1-9(11,12)10(13,14)8(15)6-7-2-4-18(16,17)5-3-7/h7-8,15H,2-6H2,1H3 |
| InChIKey | CUUYKKDCFQXTMZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|