C9H16O3S — CID 84778007
1-[(1,1-dioxothian-4-yl)methyl]cyclopropan-1-ol (PubChem CID 84778007) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(1,1-dioxothian-4-yl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 84778007 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)methyl]cyclopropan-1-ol |
| SMILES | O=S1(=O)CCC(CC2(O)CC2)CC1 |
| InChI | InChI=1S/C9H16O3S/c10-9(3-4-9)7-8-1-5-13(11,12)6-2-8/h8,10H,1-7H2 |
| InChIKey | VVVLCMSBWGCKHH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |