C12H23NO2S — CID 115074188
1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-amine (PubChem CID 115074188) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-amine.
| Compound Name | 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 115074188 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-amine |
| SMILES | NC1(CCC2CCS(=O)(=O)CC2)CCCC1 |
| InChI | InChI=1S/C12H23NO2S/c13-12(6-1-2-7-12)8-3-11-4-9-16(14,15)10-5-11/h11H,1-10,13H2 |
| InChIKey | LBJSQILWWFTYLN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |