C9H19NO3S — CID 117104683
O-[1-(1,1-dioxothian-4-yl)-2-methylpropan-2-yl]hydroxylamine (PubChem CID 117104683) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is O-[1-(1,1-dioxothian-4-yl)-2-methylpropan-2-yl]hydroxylamine.
| Compound Name | O-[1-(1,1-dioxothian-4-yl)-2-methylpropan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 117104683 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | O-[1-(1,1-dioxothian-4-yl)-2-methylpropan-2-yl]hydroxylamine |
| SMILES | CC(C)(CC1CCS(=O)(=O)CC1)ON |
| InChI | InChI=1S/C9H19NO3S/c1-9(2,13-10)7-8-3-5-14(11,12)6-4-8/h8H,3-7,10H2,1-2H3 |
| InChIKey | GTDGDBSRFWMMOC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|