C12H22O3S — CID 115073699
1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-ol (PubChem CID 115073699) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-ol.
| Compound Name | 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 115073699 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-[2-(1,1-dioxothian-4-yl)ethyl]cyclopentan-1-ol |
| SMILES | O=S1(=O)CCC(CCC2(O)CCCC2)CC1 |
| InChI | InChI=1S/C12H22O3S/c13-12(6-1-2-7-12)8-3-11-4-9-16(14,15)10-5-11/h11,13H,1-10H2 |
| InChIKey | PVENWTQJZLLXJB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |